C24H41IN8 — CID 111841821
2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-[2-(N-ethyl-3-methylanilino)ethyl]-3-[(1-ethylpyrrolidin-2-yl)methyl]guanidine;hydroiodide (PubChem CID 111841821) has the molecular formula C24H41IN8 and a molecular weight of 568.55 g/mol. Its IUPAC name is 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-[2-(N-ethyl-3-methylanilino)ethyl]-3-[(1-ethylpyrrolidin-2-yl)methyl]guanidine;hydroiodide.
| Compound Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-[2-(N-ethyl-3-methylanilino)ethyl]-3-[(1-ethylpyrrolidin-2-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111841821 |
| Molecular Formula | C24H41IN8 |
| Molecular Weight | 568.55 g/mol |
| Exact Mass | 568.25 |
| IUPAC Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-[2-(N-ethyl-3-methylanilino)ethyl]-3-[(1-ethylpyrrolidin-2-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN(CCN/C(=N/Cc1nnc(C)n1C)NCC1CCCN1CC)c1cccc(C)c1.I |
| InChI | InChI=1S/C24H40N8.HI/c1-6-31-14-9-12-22(31)17-26-24(27-18-23-29-28-20(4)30(23)5)25-13-15-32(7-2)21-11-8-10-19(3)16-21;/h8,10-11,16,22H,6-7,9,12-15,17-18H2,1-5H3,(H2,25,26,27);1H |
| InChIKey | XYGHBZFJXLGWCZ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 73.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.55 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|