C20H31FIN7 — CID 111841581
1-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-[(1-ethylpyrrolidin-2-yl)methyl]-2-[(2-fluorophenyl)methyl]guanidine;hydroiodide (PubChem CID 111841581) has the molecular formula C20H31FIN7 and a molecular weight of 515.42 g/mol. Its IUPAC name is 1-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-[(1-ethylpyrrolidin-2-yl)methyl]-2-[(2-fluorophenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-[(1-ethylpyrrolidin-2-yl)methyl]-2-[(2-fluorophenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111841581 |
| Molecular Formula | C20H31FIN7 |
| Molecular Weight | 515.42 g/mol |
| Exact Mass | 515.17 |
| IUPAC Name | 1-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-[(1-ethylpyrrolidin-2-yl)methyl]-2-[(2-fluorophenyl)methyl]guanidine;hydroiodide |
| SMILES | CCN1CCCC1CN/C(=N\Cc1ccccc1F)NCc1nnc(C)n1C.I |
| InChI | InChI=1S/C20H30FN7.HI/c1-4-28-11-7-9-17(28)13-23-20(22-12-16-8-5-6-10-18(16)21)24-14-19-26-25-15(2)27(19)3;/h5-6,8,10,17H,4,7,9,11-14H2,1-3H3,(H2,22,23,24);1H |
| InChIKey | LSHCDYBPRUEWHU-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 70.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.42 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|