C23H38IN7 — CID 111330879
1-cyclohexyl-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-[2-(N-ethyl-3-methylanilino)ethyl]guanidine;hydroiodide (PubChem CID 111330879) has the molecular formula C23H38IN7 and a molecular weight of 539.51 g/mol. Its IUPAC name is 1-cyclohexyl-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-[2-(N-ethyl-3-methylanilino)ethyl]guanidine;hydroiodide.
| Compound Name | 1-cyclohexyl-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-[2-(N-ethyl-3-methylanilino)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111330879 |
| Molecular Formula | C23H38IN7 |
| Molecular Weight | 539.51 g/mol |
| Exact Mass | 539.22 |
| IUPAC Name | 1-cyclohexyl-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-[2-(N-ethyl-3-methylanilino)ethyl]guanidine;hydroiodide |
| SMILES | CCN(CCN/C(=N\Cc1nnc(C)n1C)NC1CCCCC1)c1cccc(C)c1.I |
| InChI | InChI=1S/C23H37N7.HI/c1-5-30(21-13-9-10-18(2)16-21)15-14-24-23(26-20-11-7-6-8-12-20)25-17-22-28-27-19(3)29(22)4;/h9-10,13,16,20H,5-8,11-12,14-15,17H2,1-4H3,(H2,24,25,26);1H |
| InChIKey | PDZVXJKJTVJNER-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 70.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.51 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|