C19H25F3N6O — CID 111541652
1-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(oxolan-2-ylmethyl)-2-[[3-(trifluoromethyl)phenyl]methyl]guanidine (PubChem CID 111541652) has the molecular formula C19H25F3N6O and a molecular weight of 410.44 g/mol. Its IUPAC name is 1-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(oxolan-2-ylmethyl)-2-[[3-(trifluoromethyl)phenyl]methyl]guanidine.
| Compound Name | 1-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(oxolan-2-ylmethyl)-2-[[3-(trifluoromethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111541652 |
| Molecular Formula | C19H25F3N6O |
| Molecular Weight | 410.44 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | 1-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(oxolan-2-ylmethyl)-2-[[3-(trifluoromethyl)phenyl]methyl]guanidine |
| SMILES | Cc1nnc(CN/C(=N/Cc2cccc(C(F)(F)F)c2)NCC2CCCO2)n1C |
| InChI | InChI=1S/C19H25F3N6O/c1-13-26-27-17(28(13)2)12-25-18(24-11-16-7-4-8-29-16)23-10-14-5-3-6-15(9-14)19(20,21)22/h3,5-6,9,16H,4,7-8,10-12H2,1-2H3,(H2,23,24,25) |
| InChIKey | GWTVSCPPPOLVHG-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.44 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|