C20H29F3IN5 — CID 111711634
1-ethyl-2-(3-imidazol-1-ylpropyl)-3-[3-[3-(trifluoromethyl)phenyl]butyl]guanidine;hydroiodide (PubChem CID 111711634) has the molecular formula C20H29F3IN5 and a molecular weight of 523.39 g/mol. Its IUPAC name is 1-ethyl-2-(3-imidazol-1-ylpropyl)-3-[3-[3-(trifluoromethyl)phenyl]butyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-(3-imidazol-1-ylpropyl)-3-[3-[3-(trifluoromethyl)phenyl]butyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111711634 |
| Molecular Formula | C20H29F3IN5 |
| Molecular Weight | 523.39 g/mol |
| Exact Mass | 523.14 |
| IUPAC Name | 1-ethyl-2-(3-imidazol-1-ylpropyl)-3-[3-[3-(trifluoromethyl)phenyl]butyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCn1ccnc1)NCCC(C)c1cccc(C(F)(F)F)c1.I |
| InChI | InChI=1S/C20H28F3N5.HI/c1-3-25-19(26-9-5-12-28-13-11-24-15-28)27-10-8-16(2)17-6-4-7-18(14-17)20(21,22)23;/h4,6-7,11,13-16H,3,5,8-10,12H2,1-2H3,(H2,25,26,27);1H |
| InChIKey | UUIJNHAAHJYEFK-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.39 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|