C12H20F3IN4S — CID 111987882
2-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-1-ethyl-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide (PubChem CID 111987882) has the molecular formula C12H20F3IN4S and a molecular weight of 436.29 g/mol. Its IUPAC name is 2-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-1-ethyl-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide.
| Compound Name | 2-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-1-ethyl-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111987882 |
| Molecular Formula | C12H20F3IN4S |
| Molecular Weight | 436.29 g/mol |
| Exact Mass | 436.04 |
| IUPAC Name | 2-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-1-ethyl-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1nc(C)c(C)s1)NCCC(F)(F)F.I |
| InChI | InChI=1S/C12H19F3N4S.HI/c1-4-16-11(17-6-5-12(13,14)15)18-7-10-19-8(2)9(3)20-10;/h4-7H2,1-3H3,(H2,16,17,18);1H |
| InChIKey | CABLEOQFIDMNJO-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.29 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|