C16H21IN4O — CID 110917067
2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-1-phenylguanidine;hydroiodide (PubChem CID 110917067) has the molecular formula C16H21IN4O and a molecular weight of 412.28 g/mol. Its IUPAC name is 2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-1-phenylguanidine;hydroiodide.
| Compound Name | 2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-1-phenylguanidine;hydroiodide |
|---|---|
| PubChem CID | 110917067 |
| Molecular Formula | C16H21IN4O |
| Molecular Weight | 412.28 g/mol |
| Exact Mass | 412.08 |
| IUPAC Name | 2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-1-phenylguanidine;hydroiodide |
| SMILES | COc1c(C)cnc(C/N=C(\N)Nc2ccccc2)c1C.I |
| InChI | InChI=1S/C16H20N4O.HI/c1-11-9-18-14(12(2)15(11)21-3)10-19-16(17)20-13-7-5-4-6-8-13;/h4-9H,10H2,1-3H3,(H3,17,19,20);1H |
| InChIKey | UNUQMVVFVWVDLB-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 72.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.28 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|