C19H29F3IN3O — CID 110054165
1-cyclopentyl-2-[2-(furan-2-yl)ethyl]-3-[3-(trifluoromethyl)cyclohexyl]guanidine;hydroiodide (PubChem CID 110054165) has the molecular formula C19H29F3IN3O and a molecular weight of 499.36 g/mol. Its IUPAC name is 1-cyclopentyl-2-[2-(furan-2-yl)ethyl]-3-[3-(trifluoromethyl)cyclohexyl]guanidine;hydroiodide.
| Compound Name | 1-cyclopentyl-2-[2-(furan-2-yl)ethyl]-3-[3-(trifluoromethyl)cyclohexyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110054165 |
| Molecular Formula | C19H29F3IN3O |
| Molecular Weight | 499.36 g/mol |
| Exact Mass | 499.13 |
| IUPAC Name | 1-cyclopentyl-2-[2-(furan-2-yl)ethyl]-3-[3-(trifluoromethyl)cyclohexyl]guanidine;hydroiodide |
| SMILES | FC(F)(F)C1CCCC(N/C(=N/CCc2ccco2)NC2CCCC2)C1.I |
| InChI | InChI=1S/C19H28F3N3O.HI/c20-19(21,22)14-5-3-8-16(13-14)25-18(24-15-6-1-2-7-15)23-11-10-17-9-4-12-26-17;/h4,9,12,14-16H,1-3,5-8,10-11,13H2,(H2,23,24,25);1H |
| InChIKey | FCVGASQFGYVKDN-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 49.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.36 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|