C20H31BrIN3OS — CID 109438530
1-[2-(4-bromophenyl)cyclopropyl]-2-ethyl-3-(3-ethylsulfinylcyclohexyl)guanidine;hydroiodide (PubChem CID 109438530) has the molecular formula C20H31BrIN3OS and a molecular weight of 568.36 g/mol. Its IUPAC name is 1-[2-(4-bromophenyl)cyclopropyl]-2-ethyl-3-(3-ethylsulfinylcyclohexyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(4-bromophenyl)cyclopropyl]-2-ethyl-3-(3-ethylsulfinylcyclohexyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109438530 |
| Molecular Formula | C20H31BrIN3OS |
| Molecular Weight | 568.36 g/mol |
| Exact Mass | 567.04 |
| IUPAC Name | 1-[2-(4-bromophenyl)cyclopropyl]-2-ethyl-3-(3-ethylsulfinylcyclohexyl)guanidine;hydroiodide |
| SMILES | CC/N=C(/NC1CCCC(S(=O)CC)C1)NC1CC1c1ccc(Br)cc1.I |
| InChI | InChI=1S/C20H30BrN3OS.HI/c1-3-22-20(23-16-6-5-7-17(12-16)26(25)4-2)24-19-13-18(19)14-8-10-15(21)11-9-14;/h8-11,16-19H,3-7,12-13H2,1-2H3,(H2,22,23,24);1H |
| InChIKey | BYILLNUGSFASEH-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.36 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|