C19H36IN3O2S — CID 109437846
1-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-2-ethyl-3-(3-ethylsulfinylcyclohexyl)guanidine;hydroiodide (PubChem CID 109437846) has the molecular formula C19H36IN3O2S and a molecular weight of 497.49 g/mol. Its IUPAC name is 1-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-2-ethyl-3-(3-ethylsulfinylcyclohexyl)guanidine;hydroiodide.
| Compound Name | 1-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-2-ethyl-3-(3-ethylsulfinylcyclohexyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109437846 |
| Molecular Formula | C19H36IN3O2S |
| Molecular Weight | 497.49 g/mol |
| Exact Mass | 497.16 |
| IUPAC Name | 1-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-2-ethyl-3-(3-ethylsulfinylcyclohexyl)guanidine;hydroiodide |
| SMILES | CC/N=C(\NC1CCCC(S(=O)CC)C1)NC1C2CCOC2C1(C)C.I |
| InChI | InChI=1S/C19H35N3O2S.HI/c1-5-20-18(21-13-8-7-9-14(12-13)25(23)6-2)22-16-15-10-11-24-17(15)19(16,3)4;/h13-17H,5-12H2,1-4H3,(H2,20,21,22);1H |
| InChIKey | PFXHQSGEJUUJSW-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.49 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|