C20H36IN3O2S — CID 109441054
1-(3-ethylsulfinylcyclohexyl)-2-methyl-3-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclopentane]-6-ylguanidine;hydroiodide (PubChem CID 109441054) has the molecular formula C20H36IN3O2S and a molecular weight of 509.50 g/mol. Its IUPAC name is 1-(3-ethylsulfinylcyclohexyl)-2-methyl-3-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclopentane]-6-ylguanidine;hydroiodide.
| Compound Name | 1-(3-ethylsulfinylcyclohexyl)-2-methyl-3-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclopentane]-6-ylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109441054 |
| Molecular Formula | C20H36IN3O2S |
| Molecular Weight | 509.50 g/mol |
| Exact Mass | 509.16 |
| IUPAC Name | 1-(3-ethylsulfinylcyclohexyl)-2-methyl-3-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclopentane]-6-ylguanidine;hydroiodide |
| SMILES | CCS(=O)C1CCCC(N/C(=N\C)NC2C3CCOC3C23CCCC3)C1.I |
| InChI | InChI=1S/C20H35N3O2S.HI/c1-3-26(24)15-8-6-7-14(13-15)22-19(21-2)23-17-16-9-12-25-18(16)20(17)10-4-5-11-20;/h14-18H,3-13H2,1-2H3,(H2,21,22,23);1H |
| InChIKey | GYDRCBXLJWGOQP-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.50 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|