C19H31FIN3O3S2 — CID 109440314
1-ethyl-3-(3-ethylsulfinylcyclohexyl)-2-[2-(2-fluorophenyl)sulfonylethyl]guanidine;hydroiodide (PubChem CID 109440314) has the molecular formula C19H31FIN3O3S2 and a molecular weight of 559.51 g/mol. Its IUPAC name is 1-ethyl-3-(3-ethylsulfinylcyclohexyl)-2-[2-(2-fluorophenyl)sulfonylethyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-(3-ethylsulfinylcyclohexyl)-2-[2-(2-fluorophenyl)sulfonylethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109440314 |
| Molecular Formula | C19H31FIN3O3S2 |
| Molecular Weight | 559.51 g/mol |
| Exact Mass | 559.08 |
| IUPAC Name | 1-ethyl-3-(3-ethylsulfinylcyclohexyl)-2-[2-(2-fluorophenyl)sulfonylethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCS(=O)(=O)c1ccccc1F)NC1CCCC(S(=O)CC)C1.I |
| InChI | InChI=1S/C19H30FN3O3S2.HI/c1-3-21-19(23-15-8-7-9-16(14-15)27(24)4-2)22-12-13-28(25,26)18-11-6-5-10-17(18)20;/h5-6,10-11,15-16H,3-4,7-9,12-14H2,1-2H3,(H2,21,22,23);1H |
| InChIKey | MFSAVVYMLDILNM-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.51 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|