C21H27ClFIN4OS — CID 111774591
1-[2-(2-chloro-6-fluorophenyl)cyclopropyl]-2-methyl-3-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide (PubChem CID 111774591) has the molecular formula C21H27ClFIN4OS and a molecular weight of 564.90 g/mol. Its IUPAC name is 1-[2-(2-chloro-6-fluorophenyl)cyclopropyl]-2-methyl-3-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(2-chloro-6-fluorophenyl)cyclopropyl]-2-methyl-3-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111774591 |
| Molecular Formula | C21H27ClFIN4OS |
| Molecular Weight | 564.90 g/mol |
| Exact Mass | 564.06 |
| IUPAC Name | 1-[2-(2-chloro-6-fluorophenyl)cyclopropyl]-2-methyl-3-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCC(c1cccs1)N1CCOCC1)NC1CC1c1c(F)cccc1Cl.I |
| InChI | InChI=1S/C21H26ClFN4OS.HI/c1-24-21(26-17-12-14(17)20-15(22)4-2-5-16(20)23)25-13-18(19-6-3-11-29-19)27-7-9-28-10-8-27;/h2-6,11,14,17-18H,7-10,12-13H2,1H3,(H2,24,25,26);1H |
| InChIKey | SILNLTXPFYKTRH-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.90 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|