C18H25ClFN3O — CID 109385481
3-[2-(2-chloro-6-fluorophenyl)cyclopropyl]-2-ethyl-1-methyl-1-(oxolan-3-ylmethyl)guanidine (PubChem CID 109385481) has the molecular formula C18H25ClFN3O and a molecular weight of 353.87 g/mol. Its IUPAC name is 3-[2-(2-chloro-6-fluorophenyl)cyclopropyl]-2-ethyl-1-methyl-1-(oxolan-3-ylmethyl)guanidine.
| Compound Name | 3-[2-(2-chloro-6-fluorophenyl)cyclopropyl]-2-ethyl-1-methyl-1-(oxolan-3-ylmethyl)guanidine |
|---|---|
| PubChem CID | 109385481 |
| Molecular Formula | C18H25ClFN3O |
| Molecular Weight | 353.87 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | 3-[2-(2-chloro-6-fluorophenyl)cyclopropyl]-2-ethyl-1-methyl-1-(oxolan-3-ylmethyl)guanidine |
| SMILES | CC/N=C(/NC1CC1c1c(F)cccc1Cl)N(C)CC1CCOC1 |
| InChI | InChI=1S/C18H25ClFN3O/c1-3-21-18(23(2)10-12-7-8-24-11-12)22-16-9-13(16)17-14(19)5-4-6-15(17)20/h4-6,12-13,16H,3,7-11H2,1-2H3,(H,21,22) |
| InChIKey | AJAUXVFXBKGJJG-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.87 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|