C20H32IN3O — CID 109382237
1,2-dimethyl-1-(oxolan-3-ylmethyl)-3-[2-(4-propan-2-ylphenyl)cyclopropyl]guanidine;hydroiodide (PubChem CID 109382237) has the molecular formula C20H32IN3O and a molecular weight of 457.40 g/mol. Its IUPAC name is 1,2-dimethyl-1-(oxolan-3-ylmethyl)-3-[2-(4-propan-2-ylphenyl)cyclopropyl]guanidine;hydroiodide.
| Compound Name | 1,2-dimethyl-1-(oxolan-3-ylmethyl)-3-[2-(4-propan-2-ylphenyl)cyclopropyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109382237 |
| Molecular Formula | C20H32IN3O |
| Molecular Weight | 457.40 g/mol |
| Exact Mass | 457.16 |
| IUPAC Name | 1,2-dimethyl-1-(oxolan-3-ylmethyl)-3-[2-(4-propan-2-ylphenyl)cyclopropyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NC1CC1c1ccc(C(C)C)cc1)N(C)CC1CCOC1.I |
| InChI | InChI=1S/C20H31N3O.HI/c1-14(2)16-5-7-17(8-6-16)18-11-19(18)22-20(21-3)23(4)12-15-9-10-24-13-15;/h5-8,14-15,18-19H,9-13H2,1-4H3,(H,21,22);1H |
| InChIKey | KGDVEWGVBKJSHP-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.40 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|