C15H22Cl2IN3O2 — CID 119132055
1-[(3,4-dichlorophenyl)methyl]-3-(1,4-dioxan-2-ylmethyl)-1,2-dimethylguanidine;hydroiodide (PubChem CID 119132055) has the molecular formula C15H22Cl2IN3O2 and a molecular weight of 474.17 g/mol. Its IUPAC name is 1-[(3,4-dichlorophenyl)methyl]-3-(1,4-dioxan-2-ylmethyl)-1,2-dimethylguanidine;hydroiodide.
| Compound Name | 1-[(3,4-dichlorophenyl)methyl]-3-(1,4-dioxan-2-ylmethyl)-1,2-dimethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 119132055 |
| Molecular Formula | C15H22Cl2IN3O2 |
| Molecular Weight | 474.17 g/mol |
| Exact Mass | 473.01 |
| IUPAC Name | 1-[(3,4-dichlorophenyl)methyl]-3-(1,4-dioxan-2-ylmethyl)-1,2-dimethylguanidine;hydroiodide |
| SMILES | C/N=C(\NCC1COCCO1)N(C)Cc1ccc(Cl)c(Cl)c1.I |
| InChI | InChI=1S/C15H21Cl2N3O2.HI/c1-18-15(19-8-12-10-21-5-6-22-12)20(2)9-11-3-4-13(16)14(17)7-11;/h3-4,7,12H,5-6,8-10H2,1-2H3,(H,18,19);1H |
| InChIKey | HZXQRCRHRBECIU-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.17 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|