C16H22Cl2IN5O — CID 111306230
1-[(3,4-dichlorophenyl)methyl]-1,2-dimethyl-3-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propyl]guanidine;hydroiodide (PubChem CID 111306230) has the molecular formula C16H22Cl2IN5O and a molecular weight of 498.20 g/mol. Its IUPAC name is 1-[(3,4-dichlorophenyl)methyl]-1,2-dimethyl-3-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propyl]guanidine;hydroiodide.
| Compound Name | 1-[(3,4-dichlorophenyl)methyl]-1,2-dimethyl-3-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111306230 |
| Molecular Formula | C16H22Cl2IN5O |
| Molecular Weight | 498.20 g/mol |
| Exact Mass | 497.02 |
| IUPAC Name | 1-[(3,4-dichlorophenyl)methyl]-1,2-dimethyl-3-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCc1nc(C)no1)N(C)Cc1ccc(Cl)c(Cl)c1.I |
| InChI | InChI=1S/C16H21Cl2N5O.HI/c1-11-21-15(24-22-11)5-4-8-20-16(19-2)23(3)10-12-6-7-13(17)14(18)9-12;/h6-7,9H,4-5,8,10H2,1-3H3,(H,19,20);1H |
| InChIKey | GHNVSOZKWRAUOJ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 66.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.20 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|