C15H21FIN5O — CID 111307247
1-[(4-fluorophenyl)methyl]-1,2-dimethyl-3-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]guanidine;hydroiodide (PubChem CID 111307247) has the molecular formula C15H21FIN5O and a molecular weight of 433.27 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-1,2-dimethyl-3-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-[(4-fluorophenyl)methyl]-1,2-dimethyl-3-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111307247 |
| Molecular Formula | C15H21FIN5O |
| Molecular Weight | 433.27 g/mol |
| Exact Mass | 433.08 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-1,2-dimethyl-3-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCc1nc(C)no1)N(C)Cc1ccc(F)cc1.I |
| InChI | InChI=1S/C15H20FN5O.HI/c1-11-19-14(22-20-11)8-9-18-15(17-2)21(3)10-12-4-6-13(16)7-5-12;/h4-7H,8-10H2,1-3H3,(H,17,18);1H |
| InChIKey | JEFGHQABVPMHDQ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 66.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.27 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|