C13H17FIN5O — CID 111231638
1-[(4-fluorophenyl)methyl]-2-methyl-3-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]guanidine;hydroiodide (PubChem CID 111231638) has the molecular formula C13H17FIN5O and a molecular weight of 405.22 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-2-methyl-3-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[(4-fluorophenyl)methyl]-2-methyl-3-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111231638 |
| Molecular Formula | C13H17FIN5O |
| Molecular Weight | 405.22 g/mol |
| Exact Mass | 405.05 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-2-methyl-3-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(F)cc1)NCc1nc(C)no1.I |
| InChI | InChI=1S/C13H16FN5O.HI/c1-9-18-12(20-19-9)8-17-13(15-2)16-7-10-3-5-11(14)6-4-10;/h3-6H,7-8H2,1-2H3,(H2,15,16,17);1H |
| InChIKey | GVNHHWJOZFBAHH-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 75.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.22 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|