C16H23FIN5O — CID 111854475
1-[(4-fluoro-3-methylphenyl)methyl]-2-methyl-3-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propyl]guanidine;hydroiodide (PubChem CID 111854475) has the molecular formula C16H23FIN5O and a molecular weight of 447.30 g/mol. Its IUPAC name is 1-[(4-fluoro-3-methylphenyl)methyl]-2-methyl-3-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propyl]guanidine;hydroiodide.
| Compound Name | 1-[(4-fluoro-3-methylphenyl)methyl]-2-methyl-3-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111854475 |
| Molecular Formula | C16H23FIN5O |
| Molecular Weight | 447.30 g/mol |
| Exact Mass | 447.09 |
| IUPAC Name | 1-[(4-fluoro-3-methylphenyl)methyl]-2-methyl-3-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCc1nc(C)no1)NCc1ccc(F)c(C)c1.I |
| InChI | InChI=1S/C16H22FN5O.HI/c1-11-9-13(6-7-14(11)17)10-20-16(18-3)19-8-4-5-15-21-12(2)22-23-15;/h6-7,9H,4-5,8,10H2,1-3H3,(H2,18,19,20);1H |
| InChIKey | RLRDCVHUHONAAC-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 75.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.30 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|