C15H20Cl2IN5O — CID 111197845
1-[(2,4-dichlorophenyl)methyl]-2-methyl-3-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propyl]guanidine;hydroiodide (PubChem CID 111197845) has the molecular formula C15H20Cl2IN5O and a molecular weight of 484.17 g/mol. Its IUPAC name is 1-[(2,4-dichlorophenyl)methyl]-2-methyl-3-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propyl]guanidine;hydroiodide.
| Compound Name | 1-[(2,4-dichlorophenyl)methyl]-2-methyl-3-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111197845 |
| Molecular Formula | C15H20Cl2IN5O |
| Molecular Weight | 484.17 g/mol |
| Exact Mass | 483.01 |
| IUPAC Name | 1-[(2,4-dichlorophenyl)methyl]-2-methyl-3-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCc1nc(C)no1)NCc1ccc(Cl)cc1Cl.I |
| InChI | InChI=1S/C15H19Cl2N5O.HI/c1-10-21-14(23-22-10)4-3-7-19-15(18-2)20-9-11-5-6-12(16)8-13(11)17;/h5-6,8H,3-4,7,9H2,1-2H3,(H2,18,19,20);1H |
| InChIKey | ZGBBCDZRRJOSRQ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 75.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.17 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|