C16H21F3IN5O — CID 111420474
2-methyl-1-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propyl]-3-[[4-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111420474) has the molecular formula C16H21F3IN5O and a molecular weight of 483.28 g/mol. Its IUPAC name is 2-methyl-1-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propyl]-3-[[4-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propyl]-3-[[4-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111420474 |
| Molecular Formula | C16H21F3IN5O |
| Molecular Weight | 483.28 g/mol |
| Exact Mass | 483.07 |
| IUPAC Name | 2-methyl-1-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propyl]-3-[[4-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCc1nc(C)no1)NCc1ccc(C(F)(F)F)cc1.I |
| InChI | InChI=1S/C16H20F3N5O.HI/c1-11-23-14(25-24-11)4-3-9-21-15(20-2)22-10-12-5-7-13(8-6-12)16(17,18)19;/h5-8H,3-4,9-10H2,1-2H3,(H2,20,21,22);1H |
| InChIKey | OOPVPFBTIIGMBT-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 75.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.28 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|