C18H25ClIN5O — CID 111640445
1-[[1-(3-chlorophenyl)cyclopropyl]methyl]-2-methyl-3-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propyl]guanidine;hydroiodide (PubChem CID 111640445) has the molecular formula C18H25ClIN5O and a molecular weight of 489.79 g/mol. Its IUPAC name is 1-[[1-(3-chlorophenyl)cyclopropyl]methyl]-2-methyl-3-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propyl]guanidine;hydroiodide.
| Compound Name | 1-[[1-(3-chlorophenyl)cyclopropyl]methyl]-2-methyl-3-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111640445 |
| Molecular Formula | C18H25ClIN5O |
| Molecular Weight | 489.79 g/mol |
| Exact Mass | 489.08 |
| IUPAC Name | 1-[[1-(3-chlorophenyl)cyclopropyl]methyl]-2-methyl-3-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCc1nc(C)no1)NCC1(c2cccc(Cl)c2)CC1.I |
| InChI | InChI=1S/C18H24ClN5O.HI/c1-13-23-16(25-24-13)7-4-10-21-17(20-2)22-12-18(8-9-18)14-5-3-6-15(19)11-14;/h3,5-6,11H,4,7-10,12H2,1-2H3,(H2,20,21,22);1H |
| InChIKey | VFAZYEZANWKBHW-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 75.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.79 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|