C16H20ClF2N5O2 — CID 111709363
1-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-2-methyl-3-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propyl]guanidine (PubChem CID 111709363) has the molecular formula C16H20ClF2N5O2 and a molecular weight of 387.82 g/mol. Its IUPAC name is 1-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-2-methyl-3-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propyl]guanidine.
| Compound Name | 1-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-2-methyl-3-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111709363 |
| Molecular Formula | C16H20ClF2N5O2 |
| Molecular Weight | 387.82 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | 1-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-2-methyl-3-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propyl]guanidine |
| SMILES | C/N=C(\NCCCc1nc(C)no1)NCc1cc(Cl)ccc1OC(F)F |
| InChI | InChI=1S/C16H20ClF2N5O2/c1-10-23-14(26-24-10)4-3-7-21-16(20-2)22-9-11-8-12(17)5-6-13(11)25-15(18)19/h5-6,8,15H,3-4,7,9H2,1-2H3,(H2,20,21,22) |
| InChIKey | RLSKUWZVJYKGCO-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 84.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.82 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|