C19H26ClF2N5O2 — CID 111708873
2-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-1-ethyl-3-[3-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)propyl]guanidine (PubChem CID 111708873) has the molecular formula C19H26ClF2N5O2 and a molecular weight of 429.90 g/mol. Its IUPAC name is 2-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-1-ethyl-3-[3-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)propyl]guanidine.
| Compound Name | 2-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-1-ethyl-3-[3-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111708873 |
| Molecular Formula | C19H26ClF2N5O2 |
| Molecular Weight | 429.90 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | 2-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-1-ethyl-3-[3-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)propyl]guanidine |
| SMILES | CCN/C(=N\Cc1cc(Cl)ccc1OC(F)F)NCCCc1nc(C(C)C)no1 |
| InChI | InChI=1S/C19H26ClF2N5O2/c1-4-23-19(24-9-5-6-16-26-17(12(2)3)27-29-16)25-11-13-10-14(20)7-8-15(13)28-18(21)22/h7-8,10,12,18H,4-6,9,11H2,1-3H3,(H2,23,24,25) |
| InChIKey | JFYVTEFPFIMERQ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 84.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.90 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|