C18H17ClFN5O — CID 111612169
1-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-[(4-fluorophenyl)methyl]-2-methylguanidine (PubChem CID 111612169) has the molecular formula C18H17ClFN5O and a molecular weight of 373.82 g/mol. Its IUPAC name is 1-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-[(4-fluorophenyl)methyl]-2-methylguanidine.
| Compound Name | 1-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-[(4-fluorophenyl)methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111612169 |
| Molecular Formula | C18H17ClFN5O |
| Molecular Weight | 373.82 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | 1-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-[(4-fluorophenyl)methyl]-2-methylguanidine |
| SMILES | C/N=C(\NCc1ccc(F)cc1)NCc1nc(-c2ccc(Cl)cc2)no1 |
| InChI | InChI=1S/C18H17ClFN5O/c1-21-18(22-10-12-2-8-15(20)9-3-12)23-11-16-24-17(25-26-16)13-4-6-14(19)7-5-13/h2-9H,10-11H2,1H3,(H2,21,22,23) |
| InChIKey | PSZSBKPNDWEBNX-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 75.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.82 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|