C21H20ClIN6O2 — CID 111980632
1-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-2-methyl-3-[(2-phenyl-1,3-oxazol-4-yl)methyl]guanidine;hydroiodide (PubChem CID 111980632) has the molecular formula C21H20ClIN6O2 and a molecular weight of 550.79 g/mol. Its IUPAC name is 1-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-2-methyl-3-[(2-phenyl-1,3-oxazol-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-2-methyl-3-[(2-phenyl-1,3-oxazol-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111980632 |
| Molecular Formula | C21H20ClIN6O2 |
| Molecular Weight | 550.79 g/mol |
| Exact Mass | 550.04 |
| IUPAC Name | 1-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-2-methyl-3-[(2-phenyl-1,3-oxazol-4-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1coc(-c2ccccc2)n1)NCc1nc(-c2ccc(Cl)cc2)no1.I |
| InChI | InChI=1S/C21H19ClN6O2.HI/c1-23-21(24-11-17-13-29-20(26-17)15-5-3-2-4-6-15)25-12-18-27-19(28-30-18)14-7-9-16(22)10-8-14;/h2-10,13H,11-12H2,1H3,(H2,23,24,25);1H |
| InChIKey | NLFTXGRJZARBDU-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.79 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|