C18H18ClIN8O — CID 111612286
1-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-2-methyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide (PubChem CID 111612286) has the molecular formula C18H18ClIN8O and a molecular weight of 524.75 g/mol. Its IUPAC name is 1-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-2-methyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-2-methyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111612286 |
| Molecular Formula | C18H18ClIN8O |
| Molecular Weight | 524.75 g/mol |
| Exact Mass | 524.03 |
| IUPAC Name | 1-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-2-methyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1nc(-c2ccc(Cl)cc2)no1)NCc1nnc2ccccn12.I |
| InChI | InChI=1S/C18H17ClN8O.HI/c1-20-18(21-10-15-25-24-14-4-2-3-9-27(14)15)22-11-16-23-17(26-28-16)12-5-7-13(19)8-6-12;/h2-9H,10-11H2,1H3,(H2,20,21,22);1H |
| InChIKey | RZKTTWLZDPKPCV-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 105.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.75 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|