C18H28IN5O3 — CID 111241476
1-[2-(3,4-dimethoxyphenyl)ethyl]-1,2-dimethyl-3-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]guanidine;hydroiodide (PubChem CID 111241476) has the molecular formula C18H28IN5O3 and a molecular weight of 489.36 g/mol. Its IUPAC name is 1-[2-(3,4-dimethoxyphenyl)ethyl]-1,2-dimethyl-3-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-1,2-dimethyl-3-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111241476 |
| Molecular Formula | C18H28IN5O3 |
| Molecular Weight | 489.36 g/mol |
| Exact Mass | 489.12 |
| IUPAC Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-1,2-dimethyl-3-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCc1nc(C)no1)N(C)CCc1ccc(OC)c(OC)c1.I |
| InChI | InChI=1S/C18H27N5O3.HI/c1-13-21-17(26-22-13)8-10-20-18(19-2)23(3)11-9-14-6-7-15(24-4)16(12-14)25-5;/h6-7,12H,8-11H2,1-5H3,(H,19,20);1H |
| InChIKey | HIXPGOPWCIQEMY-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 85.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.36 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|