C24H32IN3O3 — CID 111241822
1-[2-(3,4-dimethoxyphenyl)ethyl]-1,2-dimethyl-3-[2-(4-prop-2-ynoxyphenyl)ethyl]guanidine;hydroiodide (PubChem CID 111241822) has the molecular formula C24H32IN3O3 and a molecular weight of 537.44 g/mol. Its IUPAC name is 1-[2-(3,4-dimethoxyphenyl)ethyl]-1,2-dimethyl-3-[2-(4-prop-2-ynoxyphenyl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-1,2-dimethyl-3-[2-(4-prop-2-ynoxyphenyl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111241822 |
| Molecular Formula | C24H32IN3O3 |
| Molecular Weight | 537.44 g/mol |
| Exact Mass | 537.15 |
| IUPAC Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-1,2-dimethyl-3-[2-(4-prop-2-ynoxyphenyl)ethyl]guanidine;hydroiodide |
| SMILES | C#CCOc1ccc(CCN/C(=N\C)N(C)CCc2ccc(OC)c(OC)c2)cc1.I |
| InChI | InChI=1S/C24H31N3O3.HI/c1-6-17-30-21-10-7-19(8-11-21)13-15-26-24(25-2)27(3)16-14-20-9-12-22(28-4)23(18-20)29-5;/h1,7-12,18H,13-17H2,2-5H3,(H,25,26);1H |
| InChIKey | WWTGKJPVYQOUOW-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 55.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.44 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|