C16H21Cl2N5O — CID 111306047
1-[(3,4-dichlorophenyl)methyl]-3-ethyl-1-methyl-2-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]guanidine (PubChem CID 111306047) has the molecular formula C16H21Cl2N5O and a molecular weight of 370.28 g/mol. Its IUPAC name is 1-[(3,4-dichlorophenyl)methyl]-3-ethyl-1-methyl-2-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]guanidine.
| Compound Name | 1-[(3,4-dichlorophenyl)methyl]-3-ethyl-1-methyl-2-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 111306047 |
| Molecular Formula | C16H21Cl2N5O |
| Molecular Weight | 370.28 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | 1-[(3,4-dichlorophenyl)methyl]-3-ethyl-1-methyl-2-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]guanidine |
| SMILES | CCN/C(=N\CCc1nc(C)no1)N(C)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H21Cl2N5O/c1-4-19-16(20-8-7-15-21-11(2)22-24-15)23(3)10-12-5-6-13(17)14(18)9-12/h5-6,9H,4,7-8,10H2,1-3H3,(H,19,20) |
| InChIKey | YDMFXNKCRFNSDT-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 66.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.28 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|