C17H23Cl2N5O — CID 111306069
1-[(3,4-dichlorophenyl)methyl]-3-ethyl-1-methyl-2-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propyl]guanidine (PubChem CID 111306069) has the molecular formula C17H23Cl2N5O and a molecular weight of 384.31 g/mol. Its IUPAC name is 1-[(3,4-dichlorophenyl)methyl]-3-ethyl-1-methyl-2-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propyl]guanidine.
| Compound Name | 1-[(3,4-dichlorophenyl)methyl]-3-ethyl-1-methyl-2-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111306069 |
| Molecular Formula | C17H23Cl2N5O |
| Molecular Weight | 384.31 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | 1-[(3,4-dichlorophenyl)methyl]-3-ethyl-1-methyl-2-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propyl]guanidine |
| SMILES | CCN/C(=N\CCCc1nc(C)no1)N(C)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H23Cl2N5O/c1-4-20-17(21-9-5-6-16-22-12(2)23-25-16)24(3)11-13-7-8-14(18)15(19)10-13/h7-8,10H,4-6,9,11H2,1-3H3,(H,20,21) |
| InChIKey | OYZULFHRUBJPHT-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 66.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.31 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|