C15H24IN3O2 — CID 119119477
2-benzyl-3-(1,4-dioxan-2-ylmethyl)-1,1-dimethylguanidine;hydroiodide (PubChem CID 119119477) has the molecular formula C15H24IN3O2 and a molecular weight of 405.28 g/mol. Its IUPAC name is 2-benzyl-3-(1,4-dioxan-2-ylmethyl)-1,1-dimethylguanidine;hydroiodide.
| Compound Name | 2-benzyl-3-(1,4-dioxan-2-ylmethyl)-1,1-dimethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 119119477 |
| Molecular Formula | C15H24IN3O2 |
| Molecular Weight | 405.28 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | 2-benzyl-3-(1,4-dioxan-2-ylmethyl)-1,1-dimethylguanidine;hydroiodide |
| SMILES | CN(C)/C(=N\Cc1ccccc1)NCC1COCCO1.I |
| InChI | InChI=1S/C15H23N3O2.HI/c1-18(2)15(16-10-13-6-4-3-5-7-13)17-11-14-12-19-8-9-20-14;/h3-7,14H,8-12H2,1-2H3,(H,16,17);1H |
| InChIKey | LQYIWAHDPQIRMX-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.28 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|