C12H18F2IN3 — CID 111757669
2-benzyl-3-(2,2-difluoroethyl)-1,1-dimethylguanidine;hydroiodide (PubChem CID 111757669) has the molecular formula C12H18F2IN3 and a molecular weight of 369.20 g/mol. Its IUPAC name is 2-benzyl-3-(2,2-difluoroethyl)-1,1-dimethylguanidine;hydroiodide.
| Compound Name | 2-benzyl-3-(2,2-difluoroethyl)-1,1-dimethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111757669 |
| Molecular Formula | C12H18F2IN3 |
| Molecular Weight | 369.20 g/mol |
| Exact Mass | 369.05 |
| IUPAC Name | 2-benzyl-3-(2,2-difluoroethyl)-1,1-dimethylguanidine;hydroiodide |
| SMILES | CN(C)/C(=N\Cc1ccccc1)NCC(F)F.I |
| InChI | InChI=1S/C12H17F2N3.HI/c1-17(2)12(16-9-11(13)14)15-8-10-6-4-3-5-7-10;/h3-7,11H,8-9H2,1-2H3,(H,15,16);1H |
| InChIKey | PJLKFFKTQOYVAK-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.20 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|