C17H29N3O — CID 111712711
2-benzyl-3-[2-(2-hydroxyethyl)pentyl]-1,1-dimethylguanidine (PubChem CID 111712711) has the molecular formula C17H29N3O and a molecular weight of 291.44 g/mol. Its IUPAC name is 2-benzyl-3-[2-(2-hydroxyethyl)pentyl]-1,1-dimethylguanidine.
| Compound Name | 2-benzyl-3-[2-(2-hydroxyethyl)pentyl]-1,1-dimethylguanidine |
|---|---|
| PubChem CID | 111712711 |
| Molecular Formula | C17H29N3O |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.23 |
| IUPAC Name | 2-benzyl-3-[2-(2-hydroxyethyl)pentyl]-1,1-dimethylguanidine |
| SMILES | CCCC(CCO)CN/C(=N/Cc1ccccc1)N(C)C |
| InChI | InChI=1S/C17H29N3O/c1-4-8-15(11-12-21)13-18-17(20(2)3)19-14-16-9-6-5-7-10-16/h5-7,9-10,15,21H,4,8,11-14H2,1-3H3,(H,18,19) |
| InChIKey | BUDXDNLSPOQADI-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 47.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|