C17H30N4 — CID 111600570
2-benzyl-3-[2-[ethyl(propyl)amino]ethyl]-1,1-dimethylguanidine (PubChem CID 111600570) has the molecular formula C17H30N4 and a molecular weight of 290.45 g/mol. Its IUPAC name is 2-benzyl-3-[2-[ethyl(propyl)amino]ethyl]-1,1-dimethylguanidine.
| Compound Name | 2-benzyl-3-[2-[ethyl(propyl)amino]ethyl]-1,1-dimethylguanidine |
|---|---|
| PubChem CID | 111600570 |
| Molecular Formula | C17H30N4 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.25 |
| IUPAC Name | 2-benzyl-3-[2-[ethyl(propyl)amino]ethyl]-1,1-dimethylguanidine |
| SMILES | CCCN(CC)CCN/C(=N/Cc1ccccc1)N(C)C |
| InChI | InChI=1S/C17H30N4/c1-5-13-21(6-2)14-12-18-17(20(3)4)19-15-16-10-8-7-9-11-16/h7-11H,5-6,12-15H2,1-4H3,(H,18,19) |
| InChIKey | RLPZGOVSXYDTOZ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|