C18H32N4 — CID 111060043
2-benzyl-3-[4-(diethylamino)butyl]-1,1-dimethylguanidine (PubChem CID 111060043) has the molecular formula C18H32N4 and a molecular weight of 304.48 g/mol. Its IUPAC name is 2-benzyl-3-[4-(diethylamino)butyl]-1,1-dimethylguanidine.
| Compound Name | 2-benzyl-3-[4-(diethylamino)butyl]-1,1-dimethylguanidine |
|---|---|
| PubChem CID | 111060043 |
| Molecular Formula | C18H32N4 |
| Molecular Weight | 304.48 g/mol |
| Exact Mass | 304.26 |
| IUPAC Name | 2-benzyl-3-[4-(diethylamino)butyl]-1,1-dimethylguanidine |
| SMILES | CCN(CC)CCCCN/C(=N/Cc1ccccc1)N(C)C |
| InChI | InChI=1S/C18H32N4/c1-5-22(6-2)15-11-10-14-19-18(21(3)4)20-16-17-12-8-7-9-13-17/h7-9,12-13H,5-6,10-11,14-16H2,1-4H3,(H,19,20) |
| InChIKey | RHUKITAOZRTNTM-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.48 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|