C17H30IN3S — CID 110032058
2-benzyl-1,1-dimethyl-3-(6-methylsulfanylhexyl)guanidine;hydroiodide (PubChem CID 110032058) has the molecular formula C17H30IN3S and a molecular weight of 435.42 g/mol. Its IUPAC name is 2-benzyl-1,1-dimethyl-3-(6-methylsulfanylhexyl)guanidine;hydroiodide.
| Compound Name | 2-benzyl-1,1-dimethyl-3-(6-methylsulfanylhexyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 110032058 |
| Molecular Formula | C17H30IN3S |
| Molecular Weight | 435.42 g/mol |
| Exact Mass | 435.12 |
| IUPAC Name | 2-benzyl-1,1-dimethyl-3-(6-methylsulfanylhexyl)guanidine;hydroiodide |
| SMILES | CSCCCCCCN/C(=N/Cc1ccccc1)N(C)C.I |
| InChI | InChI=1S/C17H29N3S.HI/c1-20(2)17(18-13-9-4-5-10-14-21-3)19-15-16-11-7-6-8-12-16;/h6-8,11-12H,4-5,9-10,13-15H2,1-3H3,(H,18,19);1H |
| InChIKey | UPTICIOVLNRUTQ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.42 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|