C21H29N3O — CID 111093695
2-benzyl-1,1-dimethyl-3-(4-phenylmethoxybutyl)guanidine (PubChem CID 111093695) has the molecular formula C21H29N3O and a molecular weight of 339.48 g/mol. Its IUPAC name is 2-benzyl-1,1-dimethyl-3-(4-phenylmethoxybutyl)guanidine.
| Compound Name | 2-benzyl-1,1-dimethyl-3-(4-phenylmethoxybutyl)guanidine |
|---|---|
| PubChem CID | 111093695 |
| Molecular Formula | C21H29N3O |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.23 |
| IUPAC Name | 2-benzyl-1,1-dimethyl-3-(4-phenylmethoxybutyl)guanidine |
| SMILES | CN(C)/C(=N\Cc1ccccc1)NCCCCOCc1ccccc1 |
| InChI | InChI=1S/C21H29N3O/c1-24(2)21(23-17-19-11-5-3-6-12-19)22-15-9-10-16-25-18-20-13-7-4-8-14-20/h3-8,11-14H,9-10,15-18H2,1-2H3,(H,22,23) |
| InChIKey | PEYHIRQWURKYDZ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|