C15H19BrIN3O — CID 111292900
1-[(4-bromophenyl)methyl]-3-(furan-2-ylmethyl)-1,2-dimethylguanidine;hydroiodide (PubChem CID 111292900) has the molecular formula C15H19BrIN3O and a molecular weight of 464.15 g/mol. Its IUPAC name is 1-[(4-bromophenyl)methyl]-3-(furan-2-ylmethyl)-1,2-dimethylguanidine;hydroiodide.
| Compound Name | 1-[(4-bromophenyl)methyl]-3-(furan-2-ylmethyl)-1,2-dimethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111292900 |
| Molecular Formula | C15H19BrIN3O |
| Molecular Weight | 464.15 g/mol |
| Exact Mass | 462.98 |
| IUPAC Name | 1-[(4-bromophenyl)methyl]-3-(furan-2-ylmethyl)-1,2-dimethylguanidine;hydroiodide |
| SMILES | C/N=C(\NCc1ccco1)N(C)Cc1ccc(Br)cc1.I |
| InChI | InChI=1S/C15H18BrN3O.HI/c1-17-15(18-10-14-4-3-9-20-14)19(2)11-12-5-7-13(16)8-6-12;/h3-9H,10-11H2,1-2H3,(H,17,18);1H |
| InChIKey | PQPCLTHXBCBDMF-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 40.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.15 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|