C18H29FN4O3S — CID 111419415
1-[2-(2-fluorophenoxy)ethyl]-1,2-dimethyl-3-[(1-methylsulfonylpiperidin-4-yl)methyl]guanidine (PubChem CID 111419415) has the molecular formula C18H29FN4O3S and a molecular weight of 400.52 g/mol. Its IUPAC name is 1-[2-(2-fluorophenoxy)ethyl]-1,2-dimethyl-3-[(1-methylsulfonylpiperidin-4-yl)methyl]guanidine.
| Compound Name | 1-[2-(2-fluorophenoxy)ethyl]-1,2-dimethyl-3-[(1-methylsulfonylpiperidin-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111419415 |
| Molecular Formula | C18H29FN4O3S |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | 1-[2-(2-fluorophenoxy)ethyl]-1,2-dimethyl-3-[(1-methylsulfonylpiperidin-4-yl)methyl]guanidine |
| SMILES | C/N=C(/NCC1CCN(S(C)(=O)=O)CC1)N(C)CCOc1ccccc1F |
| InChI | InChI=1S/C18H29FN4O3S/c1-20-18(21-14-15-8-10-23(11-9-15)27(3,24)25)22(2)12-13-26-17-7-5-4-6-16(17)19/h4-7,15H,8-14H2,1-3H3,(H,20,21) |
| InChIKey | IPLITLKSCQKKOZ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 74.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|