C17H27BrN4O2S — CID 111292785
1-[(4-bromophenyl)methyl]-1,2-dimethyl-3-[(1-methylsulfonylpiperidin-4-yl)methyl]guanidine (PubChem CID 111292785) has the molecular formula C17H27BrN4O2S and a molecular weight of 431.40 g/mol. Its IUPAC name is 1-[(4-bromophenyl)methyl]-1,2-dimethyl-3-[(1-methylsulfonylpiperidin-4-yl)methyl]guanidine.
| Compound Name | 1-[(4-bromophenyl)methyl]-1,2-dimethyl-3-[(1-methylsulfonylpiperidin-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111292785 |
| Molecular Formula | C17H27BrN4O2S |
| Molecular Weight | 431.40 g/mol |
| Exact Mass | 430.10 |
| IUPAC Name | 1-[(4-bromophenyl)methyl]-1,2-dimethyl-3-[(1-methylsulfonylpiperidin-4-yl)methyl]guanidine |
| SMILES | C/N=C(/NCC1CCN(S(C)(=O)=O)CC1)N(C)Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C17H27BrN4O2S/c1-19-17(21(2)13-15-4-6-16(18)7-5-15)20-12-14-8-10-22(11-9-14)25(3,23)24/h4-7,14H,8-13H2,1-3H3,(H,19,20) |
| InChIKey | PDHQWGJVABYKSW-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.40 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|