C18H27ClN4 — CID 111293891
1-[(4-chlorophenyl)methyl]-3-[(1-cyclopropylpyrrolidin-3-yl)methyl]-1,2-dimethylguanidine (PubChem CID 111293891) has the molecular formula C18H27ClN4 and a molecular weight of 334.89 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-3-[(1-cyclopropylpyrrolidin-3-yl)methyl]-1,2-dimethylguanidine.
| Compound Name | 1-[(4-chlorophenyl)methyl]-3-[(1-cyclopropylpyrrolidin-3-yl)methyl]-1,2-dimethylguanidine |
|---|---|
| PubChem CID | 111293891 |
| Molecular Formula | C18H27ClN4 |
| Molecular Weight | 334.89 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-3-[(1-cyclopropylpyrrolidin-3-yl)methyl]-1,2-dimethylguanidine |
| SMILES | C/N=C(\NCC1CCN(C2CC2)C1)N(C)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H27ClN4/c1-20-18(22(2)12-14-3-5-16(19)6-4-14)21-11-15-9-10-23(13-15)17-7-8-17/h3-6,15,17H,7-13H2,1-2H3,(H,20,21) |
| InChIKey | POGDUBUEPNXADQ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.89 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|