C17H24BrF3N4 — CID 111293041
1-[(4-bromophenyl)methyl]-1,2-dimethyl-3-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]guanidine (PubChem CID 111293041) has the molecular formula C17H24BrF3N4 and a molecular weight of 421.31 g/mol. Its IUPAC name is 1-[(4-bromophenyl)methyl]-1,2-dimethyl-3-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]guanidine.
| Compound Name | 1-[(4-bromophenyl)methyl]-1,2-dimethyl-3-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]guanidine |
|---|---|
| PubChem CID | 111293041 |
| Molecular Formula | C17H24BrF3N4 |
| Molecular Weight | 421.31 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | 1-[(4-bromophenyl)methyl]-1,2-dimethyl-3-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]guanidine |
| SMILES | C/N=C(\NCC1CCN(CC(F)(F)F)C1)N(C)Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C17H24BrF3N4/c1-22-16(24(2)10-13-3-5-15(18)6-4-13)23-9-14-7-8-25(11-14)12-17(19,20)21/h3-6,14H,7-12H2,1-2H3,(H,22,23) |
| InChIKey | LSCVEVIDWXPCFN-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.31 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|