C18H27F3N4 — CID 111299723
3-[(1-ethylpyrrolidin-3-yl)methyl]-1,2-dimethyl-1-[[4-(trifluoromethyl)phenyl]methyl]guanidine (PubChem CID 111299723) has the molecular formula C18H27F3N4 and a molecular weight of 356.44 g/mol. Its IUPAC name is 3-[(1-ethylpyrrolidin-3-yl)methyl]-1,2-dimethyl-1-[[4-(trifluoromethyl)phenyl]methyl]guanidine.
| Compound Name | 3-[(1-ethylpyrrolidin-3-yl)methyl]-1,2-dimethyl-1-[[4-(trifluoromethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111299723 |
| Molecular Formula | C18H27F3N4 |
| Molecular Weight | 356.44 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | 3-[(1-ethylpyrrolidin-3-yl)methyl]-1,2-dimethyl-1-[[4-(trifluoromethyl)phenyl]methyl]guanidine |
| SMILES | CCN1CCC(CN/C(=N\C)N(C)Cc2ccc(C(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C18H27F3N4/c1-4-25-10-9-15(13-25)11-23-17(22-2)24(3)12-14-5-7-16(8-6-14)18(19,20)21/h5-8,15H,4,9-13H2,1-3H3,(H,22,23) |
| InChIKey | APOHTGWJXJUXDU-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.44 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|