C20H32F3N5 — CID 111299897
3-[2-(4-ethylpiperazin-1-yl)propyl]-1,2-dimethyl-1-[[4-(trifluoromethyl)phenyl]methyl]guanidine (PubChem CID 111299897) has the molecular formula C20H32F3N5 and a molecular weight of 399.51 g/mol. Its IUPAC name is 3-[2-(4-ethylpiperazin-1-yl)propyl]-1,2-dimethyl-1-[[4-(trifluoromethyl)phenyl]methyl]guanidine.
| Compound Name | 3-[2-(4-ethylpiperazin-1-yl)propyl]-1,2-dimethyl-1-[[4-(trifluoromethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111299897 |
| Molecular Formula | C20H32F3N5 |
| Molecular Weight | 399.51 g/mol |
| Exact Mass | 399.26 |
| IUPAC Name | 3-[2-(4-ethylpiperazin-1-yl)propyl]-1,2-dimethyl-1-[[4-(trifluoromethyl)phenyl]methyl]guanidine |
| SMILES | CCN1CCN(C(C)CN/C(=N\C)N(C)Cc2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C20H32F3N5/c1-5-27-10-12-28(13-11-27)16(2)14-25-19(24-3)26(4)15-17-6-8-18(9-7-17)20(21,22)23/h6-9,16H,5,10-15H2,1-4H3,(H,24,25) |
| InChIKey | ZLBBKTZLBUXORR-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 34.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.51 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|