C16H36IN5 — CID 111158134
1-butyl-3-[2-(4-ethylpiperazin-1-yl)propyl]-1,2-dimethylguanidine;hydroiodide (PubChem CID 111158134) has the molecular formula C16H36IN5 and a molecular weight of 425.40 g/mol. Its IUPAC name is 1-butyl-3-[2-(4-ethylpiperazin-1-yl)propyl]-1,2-dimethylguanidine;hydroiodide.
| Compound Name | 1-butyl-3-[2-(4-ethylpiperazin-1-yl)propyl]-1,2-dimethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111158134 |
| Molecular Formula | C16H36IN5 |
| Molecular Weight | 425.40 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | 1-butyl-3-[2-(4-ethylpiperazin-1-yl)propyl]-1,2-dimethylguanidine;hydroiodide |
| SMILES | CCCCN(C)/C(=N\C)NCC(C)N1CCN(CC)CC1.I |
| InChI | InChI=1S/C16H35N5.HI/c1-6-8-9-19(5)16(17-4)18-14-15(3)21-12-10-20(7-2)11-13-21;/h15H,6-14H2,1-5H3,(H,17,18);1H |
| InChIKey | LIDWZJZTXVBSKU-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 34.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.40 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|