C16H35N5 — CID 111160214
1-butyl-3-ethyl-1-methyl-2-[2-(4-methylpiperazin-1-yl)propyl]guanidine (PubChem CID 111160214) has the molecular formula C16H35N5 and a molecular weight of 297.49 g/mol. Its IUPAC name is 1-butyl-3-ethyl-1-methyl-2-[2-(4-methylpiperazin-1-yl)propyl]guanidine.
| Compound Name | 1-butyl-3-ethyl-1-methyl-2-[2-(4-methylpiperazin-1-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111160214 |
| Molecular Formula | C16H35N5 |
| Molecular Weight | 297.49 g/mol |
| Exact Mass | 297.29 |
| IUPAC Name | 1-butyl-3-ethyl-1-methyl-2-[2-(4-methylpiperazin-1-yl)propyl]guanidine |
| SMILES | CCCCN(C)/C(=N/CC(C)N1CCN(C)CC1)NCC |
| InChI | InChI=1S/C16H35N5/c1-6-8-9-20(5)16(17-7-2)18-14-15(3)21-12-10-19(4)11-13-21/h15H,6-14H2,1-5H3,(H,17,18) |
| InChIKey | YHCMFGPUBRXIAZ-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 34.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.49 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|