C20H35N5S — CID 111298857
3-ethyl-1-methyl-2-[2-(4-methylpiperazin-1-yl)propyl]-1-[(4-methylsulfanylphenyl)methyl]guanidine (PubChem CID 111298857) has the molecular formula C20H35N5S and a molecular weight of 377.60 g/mol. Its IUPAC name is 3-ethyl-1-methyl-2-[2-(4-methylpiperazin-1-yl)propyl]-1-[(4-methylsulfanylphenyl)methyl]guanidine.
| Compound Name | 3-ethyl-1-methyl-2-[2-(4-methylpiperazin-1-yl)propyl]-1-[(4-methylsulfanylphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111298857 |
| Molecular Formula | C20H35N5S |
| Molecular Weight | 377.60 g/mol |
| Exact Mass | 377.26 |
| IUPAC Name | 3-ethyl-1-methyl-2-[2-(4-methylpiperazin-1-yl)propyl]-1-[(4-methylsulfanylphenyl)methyl]guanidine |
| SMILES | CCN/C(=N\CC(C)N1CCN(C)CC1)N(C)Cc1ccc(SC)cc1 |
| InChI | InChI=1S/C20H35N5S/c1-6-21-20(22-15-17(2)25-13-11-23(3)12-14-25)24(4)16-18-7-9-19(26-5)10-8-18/h7-10,17H,6,11-16H2,1-5H3,(H,21,22) |
| InChIKey | ITZBRHZZLXPORM-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 34.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.60 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|