C18H30BrIN4O — CID 111293294
1-[(4-bromophenyl)methyl]-3-ethyl-1-methyl-2-(2-morpholin-4-ylpropyl)guanidine;hydroiodide (PubChem CID 111293294) has the molecular formula C18H30BrIN4O and a molecular weight of 525.27 g/mol. Its IUPAC name is 1-[(4-bromophenyl)methyl]-3-ethyl-1-methyl-2-(2-morpholin-4-ylpropyl)guanidine;hydroiodide.
| Compound Name | 1-[(4-bromophenyl)methyl]-3-ethyl-1-methyl-2-(2-morpholin-4-ylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111293294 |
| Molecular Formula | C18H30BrIN4O |
| Molecular Weight | 525.27 g/mol |
| Exact Mass | 524.06 |
| IUPAC Name | 1-[(4-bromophenyl)methyl]-3-ethyl-1-methyl-2-(2-morpholin-4-ylpropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)N1CCOCC1)N(C)Cc1ccc(Br)cc1.I |
| InChI | InChI=1S/C18H29BrN4O.HI/c1-4-20-18(21-13-15(2)23-9-11-24-12-10-23)22(3)14-16-5-7-17(19)8-6-16;/h5-8,15H,4,9-14H2,1-3H3,(H,20,21);1H |
| InChIKey | UQYFFAPWSDDRNP-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.27 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|